C15H22N2O — CID 141207849
[4-[(1S)-1-aminoethyl]phenyl]-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol (PubChem CID 141207849) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is [4-[(1S)-1-aminoethyl]phenyl]-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol.
| Compound Name | [4-[(1S)-1-aminoethyl]phenyl]-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol |
|---|---|
| PubChem CID | 141207849 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [4-[(1S)-1-aminoethyl]phenyl]-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol |
| SMILES | C[C@H](N)c1ccc(C(O)C2=CCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O/c1-11(16)12-3-5-13(6-4-12)15(18)14-7-9-17(2)10-8-14/h3-7,11,15,18H,8-10,16H2,1-2H3/t11-,15?/m0/s1 |
| InChIKey | GXIXEFSKUZRQLB-VPHXOMNUSA-N |
| XLogP | 2.00 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|