C15H27NO4 — CID 135171733
7-O-tert-butyl 1-O-methyl 3,3-dimethyl-2-(methylideneamino)heptanedioate (PubChem CID 135171733) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-methyl 3,3-dimethyl-2-(methylideneamino)heptanedioate.
| Compound Name | 7-O-tert-butyl 1-O-methyl 3,3-dimethyl-2-(methylideneamino)heptanedioate |
|---|---|
| PubChem CID | 135171733 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 7-O-tert-butyl 1-O-methyl 3,3-dimethyl-2-(methylideneamino)heptanedioate |
| SMILES | C=NC(C(=O)OC)C(C)(C)CCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-14(2,3)20-11(17)9-8-10-15(4,5)12(16-6)13(18)19-7/h12H,6,8-10H2,1-5,7H3 |
| InChIKey | DPNMVOLIEGKMKI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|