C25H36N3O8P — CID 135172043
tert-butyl 2-[3-acetyl-5-(cyclopropylcarbamoylamino)-6-(diethoxyphosphorylmethoxy)indol-1-yl]acetate (PubChem CID 135172043) has the molecular formula C25H36N3O8P and a molecular weight of 537.55 g/mol. Its IUPAC name is tert-butyl 2-[3-acetyl-5-(cyclopropylcarbamoylamino)-6-(diethoxyphosphorylmethoxy)indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-acetyl-5-(cyclopropylcarbamoylamino)-6-(diethoxyphosphorylmethoxy)indol-1-yl]acetate |
|---|---|
| PubChem CID | 135172043 |
| Molecular Formula | C25H36N3O8P |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | tert-butyl 2-[3-acetyl-5-(cyclopropylcarbamoylamino)-6-(diethoxyphosphorylmethoxy)indol-1-yl]acetate |
| SMILES | CCOP(=O)(COc1cc2c(cc1NC(=O)NC1CC1)c(C(C)=O)cn2CC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C25H36N3O8P/c1-7-34-37(32,35-8-2)15-33-22-12-21-18(11-20(22)27-24(31)26-17-9-10-17)19(16(3)29)13-28(21)14-23(30)36-25(4,5)6/h11-13,17H,7-10,14-15H2,1-6H3,(H2,26,27,31) |
| InChIKey | PPOYGLSMSAYKHA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|