C25H41NO10P2 — CID 135171692
tert-butyl 2-[5-diethoxyphosphoryl-6-(diethoxyphosphorylmethoxy)-3-(1-hydroxyethyl)indol-1-yl]acetate (PubChem CID 135171692) has the molecular formula C25H41NO10P2 and a molecular weight of 577.55 g/mol. Its IUPAC name is tert-butyl 2-[5-diethoxyphosphoryl-6-(diethoxyphosphorylmethoxy)-3-(1-hydroxyethyl)indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[5-diethoxyphosphoryl-6-(diethoxyphosphorylmethoxy)-3-(1-hydroxyethyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 135171692 |
| Molecular Formula | C25H41NO10P2 |
| Molecular Weight | 577.55 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | tert-butyl 2-[5-diethoxyphosphoryl-6-(diethoxyphosphorylmethoxy)-3-(1-hydroxyethyl)indol-1-yl]acetate |
| SMILES | CCOP(=O)(COc1cc2c(cc1P(=O)(OCC)OCC)c(C(C)O)cn2CC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C25H41NO10P2/c1-9-32-37(29,33-10-2)17-31-22-14-21-19(13-23(22)38(30,34-11-3)35-12-4)20(18(5)27)15-26(21)16-24(28)36-25(6,7)8/h13-15,18,27H,9-12,16-17H2,1-8H3 |
| InChIKey | NMBHGGSARFQXEF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|