C27H33F3N4O2S — CID 135172240
2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]benzoic acid (PubChem CID 135172240) has the molecular formula C27H33F3N4O2S and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]benzoic acid.
| Compound Name | 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 135172240 |
| Molecular Formula | C27H33F3N4O2S |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-[4-[cyclohexyl(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]benzoic acid |
| SMILES | C=N/C(=N\SCNc1cc(-c2ccccc2C(=O)O)ccc1N(CC(C)C)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C27H33F3N4O2S/c1-18(2)16-34(20-9-5-4-6-10-20)24-14-13-19(21-11-7-8-12-22(21)25(35)36)15-23(24)32-17-37-33-26(31-3)27(28,29)30/h7-8,11-15,18,20,32H,3-6,9-10,16-17H2,1-2H3,(H,35,36)/b33-26- |
| InChIKey | PZAHQIXTAQUFRC-MKFPQRGTSA-N |
| XLogP | 7.53 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|