C27H38F3N5O3S — CID 142383569
3-[4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]butanoic acid (PubChem CID 142383569) has the molecular formula C27H38F3N5O3S and a molecular weight of 569.69 g/mol. Its IUPAC name is 3-[4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]butanoic acid.
| Compound Name | 3-[4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 142383569 |
| Molecular Formula | C27H38F3N5O3S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 3-[4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-[[(Z)-[2,2,2-trifluoro-1-(methylideneamino)ethylidene]amino]sulfanylmethylamino]phenyl]butanoic acid |
| SMILES | C=N/C(=N\SCNc1cc(C(C)CC(=O)O)ccc1N(CC(C)C)C1CCN(C(=O)C2CC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C27H38F3N5O3S/c1-17(2)15-35(21-9-11-34(12-10-21)25(38)19-5-6-19)23-8-7-20(18(3)13-24(36)37)14-22(23)32-16-39-33-26(31-4)27(28,29)30/h7-8,14,17-19,21,32H,4-6,9-13,15-16H2,1-3H3,(H,36,37)/b33-26- |
| InChIKey | LWKOPBHSLASDCO-MKFPQRGTSA-N |
| XLogP | 5.81 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|