C23H31N3O2 — CID 135171942
methyl 3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]pyridine-2-carboxylate (PubChem CID 135171942) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 135171942 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | methyl 3-[3-amino-4-[cyclohexyl(2-methylpropyl)amino]phenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncccc1-c1ccc(N(CC(C)C)C2CCCCC2)c(N)c1 |
| InChI | InChI=1S/C23H31N3O2/c1-16(2)15-26(18-8-5-4-6-9-18)21-12-11-17(14-20(21)24)19-10-7-13-25-22(19)23(27)28-3/h7,10-14,16,18H,4-6,8-9,15,24H2,1-3H3 |
| InChIKey | LOVQMGKVMRLDSE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|