C20H32N2O3 — CID 130331102
methyl 2-[3-amino-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]-2-methylpropanoate (PubChem CID 130331102) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is methyl 2-[3-amino-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]-2-methylpropanoate.
| Compound Name | methyl 2-[3-amino-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 130331102 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | methyl 2-[3-amino-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1ccc(N(CC(C)C)C2CCOCC2)c(N)c1 |
| InChI | InChI=1S/C20H32N2O3/c1-14(2)13-22(16-8-10-25-11-9-16)18-7-6-15(12-17(18)21)20(3,4)19(23)24-5/h6-7,12,14,16H,8-11,13,21H2,1-5H3 |
| InChIKey | FSKPRHBQTDMVJJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|