C8H11N3 — CID 135176233
1-ethenyl-N,3-dimethylpyrazin-2-imine (PubChem CID 135176233) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-ethenyl-N,3-dimethylpyrazin-2-imine.
| Compound Name | 1-ethenyl-N,3-dimethylpyrazin-2-imine |
|---|---|
| PubChem CID | 135176233 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-ethenyl-N,3-dimethylpyrazin-2-imine |
| SMILES | C=Cn1ccnc(C)/c1=N\C |
| InChI | InChI=1S/C8H11N3/c1-4-11-6-5-10-7(2)8(11)9-3/h4-6H,1H2,2-3H3/b9-8+ |
| InChIKey | DGCWDODUUKERJS-CMDGGOBGSA-N |
| XLogP | 0.82 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |