C17H26F2O — CID 135178821
(5E)-5-[(E)-1,1-difluoro-2-methylpent-2-en-3-yl]-3-methyldeca-1,5-dien-4-one (PubChem CID 135178821) has the molecular formula C17H26F2O and a molecular weight of 284.39 g/mol. Its IUPAC name is (5E)-5-[(E)-1,1-difluoro-2-methylpent-2-en-3-yl]-3-methyldeca-1,5-dien-4-one.
| Compound Name | (5E)-5-[(E)-1,1-difluoro-2-methylpent-2-en-3-yl]-3-methyldeca-1,5-dien-4-one |
|---|---|
| PubChem CID | 135178821 |
| Molecular Formula | C17H26F2O |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (5E)-5-[(E)-1,1-difluoro-2-methylpent-2-en-3-yl]-3-methyldeca-1,5-dien-4-one |
| SMILES | C=CC(C)C(=O)C(=C/CCCC)/C(CC)=C(\C)C(F)F |
| InChI | InChI=1S/C17H26F2O/c1-6-9-10-11-15(16(20)12(4)7-2)14(8-3)13(5)17(18)19/h7,11-12,17H,2,6,8-10H2,1,3-5H3/b14-13+,15-11+ |
| InChIKey | JXIKVBRWRGBVGL-ANEDOXIYSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|