About methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate
methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate (PubChem CID 135182636) has the molecular formula C22H21NO3S
and a molecular weight of 379.48 g/mol. Its IUPAC name is methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate |
| PubChem CID | 135182636 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2cccc3nc(C#CS(C)(C)C)ccc23)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-25-22(24)16-8-11-18(12-9-16)26-21-7-5-6-20-19(21)13-10-17(23-20)14-15-27(2,3)4/h5-13H,1-4H3 |
| InChIKey | DTLNTZQNQYPZCB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate?
The IUPAC name of methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate (CID 135182636) is methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate.
What is the SMILES notation for methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate?
The canonical SMILES for methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate is COC(=O)c1ccc(Oc2cccc3nc(C#CS(C)(C)C)ccc23)cc1.
What is the InChIKey of methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate?
The InChIKey is DTLNTZQNQYPZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3S/c1-25-22(24)16-8-11-18(12-9-16)26-21-7-5-6-20-19(21)13-10-17(23-20)14-15-27(2,3)4/h5-13H,1-4H3.
What are the key properties of methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate?
methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate has a molecular weight of 379.48 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[2-(trimethyl-λ4-sulfanyl)ethynyl]quinolin-5-yl]oxybenzoate is sourced from PubChem (CID 135182636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).