C30H47N9O7 — CID 135184132
2-[[(5Z)-2-acetamido-5-(phenylcarbamoylhydrazinylidene)pentanoyl]amino]-N-[1-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-3-methyl-1-oxopentan-2-yl]pentanediamide (PubChem CID 135184132) has the molecular formula C30H47N9O7 and a molecular weight of 645.76 g/mol. Its IUPAC name is 2-[[(5Z)-2-acetamido-5-(phenylcarbamoylhydrazinylidene)pentanoyl]amino]-N-[1-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-3-methyl-1-oxopentan-2-yl]pentanediamide.
| Compound Name | 2-[[(5Z)-2-acetamido-5-(phenylcarbamoylhydrazinylidene)pentanoyl]amino]-N-[1-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-3-methyl-1-oxopentan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 135184132 |
| Molecular Formula | C30H47N9O7 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | 2-[[(5Z)-2-acetamido-5-(phenylcarbamoylhydrazinylidene)pentanoyl]amino]-N-[1-[(1-amino-3-methyl-1-oxobutan-2-yl)amino]-3-methyl-1-oxopentan-2-yl]pentanediamide |
| SMILES | CCC(C)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC/C=N\NC(=O)Nc1ccccc1)NC(C)=O)C(=O)NC(C(N)=O)C(C)C |
| InChI | InChI=1S/C30H47N9O7/c1-6-18(4)25(29(45)37-24(17(2)3)26(32)42)38-28(44)22(14-15-23(31)41)36-27(43)21(34-19(5)40)13-10-16-33-39-30(46)35-20-11-8-7-9-12-20/h7-9,11-12,16-18,21-22,24-25H,6,10,13-15H2,1-5H3,(H2,31,41)(H2,32,42)(H,34,40)(H,36,43)(H,37,45)(H,38,44)(H2,35,39,46)/b33-16- |
| InChIKey | BACOCIIQRHVRIF-BJUCDSOZSA-N |
| XLogP | -0.01 |
| TPSA | 256.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|