C9H19ClN2 — CID 135184579
1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-amine;hydrochloride (PubChem CID 135184579) has the molecular formula C9H19ClN2 and a molecular weight of 190.72 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-amine;hydrochloride.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 135184579 |
| Molecular Formula | C9H19ClN2 |
| Molecular Weight | 190.72 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-amine;hydrochloride |
| SMILES | Cl.NC1CCC2CNCCC2C1 |
| InChI | InChI=1S/C9H18N2.ClH/c10-9-2-1-8-6-11-4-3-7(8)5-9;/h7-9,11H,1-6,10H2;1H |
| InChIKey | LYAOHKHYMSGQEZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.72 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |