C20H14N2O5 — CID 1351865
(4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydro-1H-benzo[h]quinolin-2-one (PubChem CID 1351865) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is (4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydro-1H-benzo[h]quinolin-2-one.
| Compound Name | (4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
|---|---|
| PubChem CID | 1351865 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (4R)-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
| SMILES | O=C1C[C@@H](c2cc3c(cc2[N+](=O)[O-])OCO3)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C20H14N2O5/c23-19-8-14(13-6-5-11-3-1-2-4-12(11)20(13)21-19)15-7-17-18(27-10-26-17)9-16(15)22(24)25/h1-7,9,14H,8,10H2,(H,21,23)/t14-/m1/s1 |
| InChIKey | DBTRBNOGOBENDT-CQSZACIVSA-N |
| XLogP | 3.95 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|