C18H24N2O2 — CID 135187547
(8aR)-2-(2,2-dimethylpropanoyl)-5,5,8a-trimethyl-6-oxo-1,3-dihydroisoquinoline-7-carbonitrile (PubChem CID 135187547) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (8aR)-2-(2,2-dimethylpropanoyl)-5,5,8a-trimethyl-6-oxo-1,3-dihydroisoquinoline-7-carbonitrile.
| Compound Name | (8aR)-2-(2,2-dimethylpropanoyl)-5,5,8a-trimethyl-6-oxo-1,3-dihydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135187547 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (8aR)-2-(2,2-dimethylpropanoyl)-5,5,8a-trimethyl-6-oxo-1,3-dihydroisoquinoline-7-carbonitrile |
| SMILES | CC(C)(C)C(=O)N1CC=C2C(C)(C)C(=O)C(C#N)=C[C@@]2(C)C1 |
| InChI | InChI=1S/C18H24N2O2/c1-16(2,3)15(22)20-8-7-13-17(4,5)14(21)12(10-19)9-18(13,6)11-20/h7,9H,8,11H2,1-6H3/t18-/m0/s1 |
| InChIKey | TXELRLKXCOUBMC-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|