C13H16N2O — CID 135194294
5,5,8a-trimethyl-6-oxo-2,3-dihydro-1H-isoquinoline-7-carbonitrile (PubChem CID 135194294) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5,5,8a-trimethyl-6-oxo-2,3-dihydro-1H-isoquinoline-7-carbonitrile.
| Compound Name | 5,5,8a-trimethyl-6-oxo-2,3-dihydro-1H-isoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135194294 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5,5,8a-trimethyl-6-oxo-2,3-dihydro-1H-isoquinoline-7-carbonitrile |
| SMILES | CC12C=C(C#N)C(=O)C(C)(C)C1=CCNC2 |
| InChI | InChI=1S/C13H16N2O/c1-12(2)10-4-5-15-8-13(10,3)6-9(7-14)11(12)16/h4,6,15H,5,8H2,1-3H3 |
| InChIKey | ZWLWVFCWFFNHSL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|