C11H16FN3O2 — CID 135190319
1-amino-3-[4-fluoro-2-(hydroxymethyl)-3-methylcyclohepta-1,3,6-trien-1-yl]-1-methylurea (PubChem CID 135190319) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is 1-amino-3-[4-fluoro-2-(hydroxymethyl)-3-methylcyclohepta-1,3,6-trien-1-yl]-1-methylurea.
| Compound Name | 1-amino-3-[4-fluoro-2-(hydroxymethyl)-3-methylcyclohepta-1,3,6-trien-1-yl]-1-methylurea |
|---|---|
| PubChem CID | 135190319 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-amino-3-[4-fluoro-2-(hydroxymethyl)-3-methylcyclohepta-1,3,6-trien-1-yl]-1-methylurea |
| SMILES | CC1=C(F)CC=CC(NC(=O)N(C)N)=C1CO |
| InChI | InChI=1S/C11H16FN3O2/c1-7-8(6-16)10(5-3-4-9(7)12)14-11(17)15(2)13/h3,5,16H,4,6,13H2,1-2H3,(H,14,17) |
| InChIKey | KQJULOUNNKLTJX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|