C8H13N3 — CID 135191061
(5E)-5-[1-(methylamino)ethylidene]-2H-pyridin-6-amine (PubChem CID 135191061) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is (5E)-5-[1-(methylamino)ethylidene]-2H-pyridin-6-amine.
| Compound Name | (5E)-5-[1-(methylamino)ethylidene]-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 135191061 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (5E)-5-[1-(methylamino)ethylidene]-2H-pyridin-6-amine |
| SMILES | CN/C(C)=C1\C=CCN=C1N |
| InChI | InChI=1S/C8H13N3/c1-6(10-2)7-4-3-5-11-8(7)9/h3-4,10H,5H2,1-2H3,(H2,9,11)/b7-6+ |
| InChIKey | PZESRPZYWONVQU-VOTSOKGWSA-N |
| XLogP | 0.41 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |