C9H13ClO — CID 135191708
(1S,7R)-4-chloro-2-methylbicyclo[5.1.0]oct-3-en-1-ol (PubChem CID 135191708) has the molecular formula C9H13ClO and a molecular weight of 172.65 g/mol. Its IUPAC name is (1S,7R)-4-chloro-2-methylbicyclo[5.1.0]oct-3-en-1-ol.
| Compound Name | (1S,7R)-4-chloro-2-methylbicyclo[5.1.0]oct-3-en-1-ol |
|---|---|
| PubChem CID | 135191708 |
| Molecular Formula | C9H13ClO |
| Molecular Weight | 172.65 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (1S,7R)-4-chloro-2-methylbicyclo[5.1.0]oct-3-en-1-ol |
| SMILES | CC1C=C(Cl)CC[C@@H]2C[C@@]12O |
| InChI | InChI=1S/C9H13ClO/c1-6-4-8(10)3-2-7-5-9(6,7)11/h4,6-7,11H,2-3,5H2,1H3/t6?,7-,9-/m1/s1 |
| InChIKey | GGJFWQYBGBFOLP-QIEYWLDOSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.65 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |