C8H10Cl2O2 — CID 177307332
1,4-dichloro-3,6-dimethylcyclohexa-2,4-diene-1,2-diol (PubChem CID 177307332) has the molecular formula C8H10Cl2O2 and a molecular weight of 209.07 g/mol. Its IUPAC name is 1,4-dichloro-3,6-dimethylcyclohexa-2,4-diene-1,2-diol.
| Compound Name | 1,4-dichloro-3,6-dimethylcyclohexa-2,4-diene-1,2-diol |
|---|---|
| PubChem CID | 177307332 |
| Molecular Formula | C8H10Cl2O2 |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 1,4-dichloro-3,6-dimethylcyclohexa-2,4-diene-1,2-diol |
| SMILES | CC1=C(O)C(O)(Cl)C(C)C=C1Cl |
| InChI | InChI=1S/C8H10Cl2O2/c1-4-3-6(9)5(2)7(11)8(4,10)12/h3-4,11-12H,1-2H3 |
| InChIKey | NVKMSKORTIWPNJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|