C21H21F2N5O2 — CID 135192038
N-[(2R)-4-(4-fluoro-2-formamidophenyl)butan-2-yl]-5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 135192038) has the molecular formula C21H21F2N5O2 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[(2R)-4-(4-fluoro-2-formamidophenyl)butan-2-yl]-5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(2R)-4-(4-fluoro-2-formamidophenyl)butan-2-yl]-5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 135192038 |
| Molecular Formula | C21H21F2N5O2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | N-[(2R)-4-(4-fluoro-2-formamidophenyl)butan-2-yl]-5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | C[C@H](CCc1ccc(F)cc1NC=O)NC(=O)c1n[nH]c(Cc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H21F2N5O2/c1-13(5-6-15-7-8-17(23)11-18(15)24-12-29)25-21(30)20-26-19(27-28-20)10-14-3-2-4-16(22)9-14/h2-4,7-9,11-13H,5-6,10H2,1H3,(H,24,29)(H,25,30)(H,26,27,28)/t13-/m1/s1 |
| InChIKey | OIPVZNXVFGXZKY-CYBMUJFWSA-N |
| XLogP | 2.99 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|