C19H21ClFN3OS — CID 135192915
methyl 3-(2-chloro-3-fluorophenyl)-N-(6-methoxy-3-pyridinyl)-3-methylpyrrolidine-1-carboximidothioate (PubChem CID 135192915) has the molecular formula C19H21ClFN3OS and a molecular weight of 393.92 g/mol. Its IUPAC name is methyl 3-(2-chloro-3-fluorophenyl)-N-(6-methoxy-3-pyridinyl)-3-methylpyrrolidine-1-carboximidothioate.
| Compound Name | methyl 3-(2-chloro-3-fluorophenyl)-N-(6-methoxy-3-pyridinyl)-3-methylpyrrolidine-1-carboximidothioate |
|---|---|
| PubChem CID | 135192915 |
| Molecular Formula | C19H21ClFN3OS |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | methyl 3-(2-chloro-3-fluorophenyl)-N-(6-methoxy-3-pyridinyl)-3-methylpyrrolidine-1-carboximidothioate |
| SMILES | COc1ccc(/N=C(\SC)N2CCC(C)(c3cccc(F)c3Cl)C2)cn1 |
| InChI | InChI=1S/C19H21ClFN3OS/c1-19(14-5-4-6-15(21)17(14)20)9-10-24(12-19)18(26-3)23-13-7-8-16(25-2)22-11-13/h4-8,11H,9-10,12H2,1-3H3/b23-18- |
| InChIKey | RGFMOYFGVFYDJI-NKFKGCMQSA-N |
| XLogP | 4.90 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|