C20H19ClFN3OS — CID 135192982
methyl (3S,4S)-3-(2-chloro-4-fluorophenyl)-4-ethynyl-N-(6-methoxy-3-pyridinyl)pyrrolidine-1-carboximidothioate (PubChem CID 135192982) has the molecular formula C20H19ClFN3OS and a molecular weight of 403.91 g/mol. Its IUPAC name is methyl (3S,4S)-3-(2-chloro-4-fluorophenyl)-4-ethynyl-N-(6-methoxy-3-pyridinyl)pyrrolidine-1-carboximidothioate.
| Compound Name | methyl (3S,4S)-3-(2-chloro-4-fluorophenyl)-4-ethynyl-N-(6-methoxy-3-pyridinyl)pyrrolidine-1-carboximidothioate |
|---|---|
| PubChem CID | 135192982 |
| Molecular Formula | C20H19ClFN3OS |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | methyl (3S,4S)-3-(2-chloro-4-fluorophenyl)-4-ethynyl-N-(6-methoxy-3-pyridinyl)pyrrolidine-1-carboximidothioate |
| SMILES | C#C[C@H]1CN(/C(=N/c2ccc(OC)nc2)SC)C[C@@H]1c1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H19ClFN3OS/c1-4-13-11-25(12-17(13)16-7-5-14(22)9-18(16)21)20(27-3)24-15-6-8-19(26-2)23-10-15/h1,5-10,13,17H,11-12H2,2-3H3/b24-20-/t13-,17-/m0/s1 |
| InChIKey | NTPQHFQOXJSYSU-QGAWVKTISA-N |
| XLogP | 4.58 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|