C19H21FN4O2S — CID 135177409
methyl 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboximidothioate (PubChem CID 135177409) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboximidothioate.
| Compound Name | methyl 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboximidothioate |
|---|---|
| PubChem CID | 135177409 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | methyl 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)-N-(6-methoxy-3-pyridinyl)azetidine-1-carboximidothioate |
| SMILES | COc1ccc(/N=C(\SC)N2CC(N3CCOc4cc(F)ccc43)C2)cn1 |
| InChI | InChI=1S/C19H21FN4O2S/c1-25-18-6-4-14(10-21-18)22-19(27-2)23-11-15(12-23)24-7-8-26-17-9-13(20)3-5-16(17)24/h3-6,9-10,15H,7-8,11-12H2,1-2H3/b22-19- |
| InChIKey | UBUWHVMWRUPLDY-QOCHGBHMSA-N |
| XLogP | 3.16 |
| TPSA | 50.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|