C11H13ClFNO — CID 135193000
[(2R)-2-(aminomethyl)-2-(2-chloro-4-fluorophenyl)cyclopropyl]methanol (PubChem CID 135193000) has the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. Its IUPAC name is [(2R)-2-(aminomethyl)-2-(2-chloro-4-fluorophenyl)cyclopropyl]methanol.
| Compound Name | [(2R)-2-(aminomethyl)-2-(2-chloro-4-fluorophenyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 135193000 |
| Molecular Formula | C11H13ClFNO |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | [(2R)-2-(aminomethyl)-2-(2-chloro-4-fluorophenyl)cyclopropyl]methanol |
| SMILES | NC[C@]1(c2ccc(F)cc2Cl)CC1CO |
| InChI | InChI=1S/C11H13ClFNO/c12-10-3-8(13)1-2-9(10)11(6-14)4-7(11)5-15/h1-3,7,15H,4-6,14H2/t7?,11-/m1/s1 |
| InChIKey | CPWMSBMIPBTOAW-PLNQYNMKSA-N |
| XLogP | 1.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |