C19H23NO3 — CID 135194797
5',5'-dimethyl-8'a-phenylspiro[1,3-dioxolane-2,6'-2,3,7,8-tetrahydroisoquinoline]-1'-one (PubChem CID 135194797) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5',5'-dimethyl-8'a-phenylspiro[1,3-dioxolane-2,6'-2,3,7,8-tetrahydroisoquinoline]-1'-one.
| Compound Name | 5',5'-dimethyl-8'a-phenylspiro[1,3-dioxolane-2,6'-2,3,7,8-tetrahydroisoquinoline]-1'-one |
|---|---|
| PubChem CID | 135194797 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 5',5'-dimethyl-8'a-phenylspiro[1,3-dioxolane-2,6'-2,3,7,8-tetrahydroisoquinoline]-1'-one |
| SMILES | CC1(C)C2=CCNC(=O)C2(c2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C19H23NO3/c1-17(2)15-8-11-20-16(21)18(15,14-6-4-3-5-7-14)9-10-19(17)22-12-13-23-19/h3-8H,9-13H2,1-2H3,(H,20,21) |
| InChIKey | MXUNJPDZLGARLB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|