C29H40N4O5 — CID 135199627
6-[[4-[[1-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]pyrrole-2-carbonyl]amino]cyclohexanecarbonyl]amino]hexanoic acid (PubChem CID 135199627) has the molecular formula C29H40N4O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is 6-[[4-[[1-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]pyrrole-2-carbonyl]amino]cyclohexanecarbonyl]amino]hexanoic acid.
| Compound Name | 6-[[4-[[1-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]pyrrole-2-carbonyl]amino]cyclohexanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 135199627 |
| Molecular Formula | C29H40N4O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 6-[[4-[[1-[2-(N-ethyl-3-methylanilino)-2-oxoethyl]pyrrole-2-carbonyl]amino]cyclohexanecarbonyl]amino]hexanoic acid |
| SMILES | CCN(C(=O)Cn1cccc1C(=O)NC1CCC(C(=O)NCCCCCC(=O)O)CC1)c1cccc(C)c1 |
| InChI | InChI=1S/C29H40N4O5/c1-3-33(24-10-7-9-21(2)19-24)26(34)20-32-18-8-11-25(32)29(38)31-23-15-13-22(14-16-23)28(37)30-17-6-4-5-12-27(35)36/h7-11,18-19,22-23H,3-6,12-17,20H2,1-2H3,(H,30,37)(H,31,38)(H,35,36) |
| InChIKey | ZIFSHCIMGSPSBK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|