About butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane
butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane (PubChem CID 135200592) has the molecular formula C18H21Br2NS
and a molecular weight of 443.25 g/mol. Its IUPAC name is butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane |
| PubChem CID | 135200592 |
| Molecular Formula | C18H21Br2NS |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane |
| SMILES | CCCCS(C)(C)n1c2cc(Br)ccc2c2ccc(Br)cc21 |
| InChI | InChI=1S/C18H21Br2NS/c1-4-5-10-22(2,3)21-17-11-13(19)6-8-15(17)16-9-7-14(20)12-18(16)21/h6-9,11-12H,4-5,10H2,1-3H3 |
| InChIKey | BJMGHIAIISOSKE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane?
The IUPAC name of butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane (CID 135200592) is butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane.
What is the SMILES notation for butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane?
The canonical SMILES for butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane is CCCCS(C)(C)n1c2cc(Br)ccc2c2ccc(Br)cc21.
What is the InChIKey of butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane?
The InChIKey is BJMGHIAIISOSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Br2NS/c1-4-5-10-22(2,3)21-17-11-13(19)6-8-15(17)16-9-7-14(20)12-18(16)21/h6-9,11-12H,4-5,10H2,1-3H3.
What are the key properties of butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane?
butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane has a molecular weight of 443.25 g/mol, XLogP of 6.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(2,7-dibromocarbazol-9-yl)-dimethyl-λ4-sulfane is sourced from PubChem (CID 135200592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).