C11H5ClF3N5 — CID 135201262
5-chloro-2-[6-(trifluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 135201262) has the molecular formula C11H5ClF3N5 and a molecular weight of 299.64 g/mol. Its IUPAC name is 5-chloro-2-[6-(trifluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[6-(trifluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 135201262 |
| Molecular Formula | C11H5ClF3N5 |
| Molecular Weight | 299.64 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 5-chloro-2-[6-(trifluoromethyl)pyridazin-4-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)c1cc(-c2nc3nc(Cl)ccc3[nH]2)cnn1 |
| InChI | InChI=1S/C11H5ClF3N5/c12-8-2-1-6-10(18-8)19-9(17-6)5-3-7(11(13,14)15)20-16-4-5/h1-4H,(H,17,18,19) |
| InChIKey | OSBULQYSSZGWQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|