C13H11ClN5+ — CID 137254292
[amino-[4-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]methylidene]azanium (PubChem CID 137254292) has the molecular formula C13H11ClN5+ and a molecular weight of 272.72 g/mol. Its IUPAC name is [amino-[4-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]methylidene]azanium.
| Compound Name | [amino-[4-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 137254292 |
| Molecular Formula | C13H11ClN5+ |
| Molecular Weight | 272.72 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [amino-[4-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1ccc(-c2nc3nc(Cl)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C13H10ClN5/c14-10-6-5-9-13(18-10)19-12(17-9)8-3-1-7(2-4-8)11(15)16/h1-6H,(H3,15,16)(H,17,18,19)/p+1 |
| InChIKey | UVJLFSHLXAQKKJ-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.72 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|