C19H18ClNO6S2 — CID 135201311
1-(benzenesulfonyl)-6-(oxolan-2-ylmethoxy)indole-3-sulfonyl chloride (PubChem CID 135201311) has the molecular formula C19H18ClNO6S2 and a molecular weight of 455.94 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-(oxolan-2-ylmethoxy)indole-3-sulfonyl chloride.
| Compound Name | 1-(benzenesulfonyl)-6-(oxolan-2-ylmethoxy)indole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 135201311 |
| Molecular Formula | C19H18ClNO6S2 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 1-(benzenesulfonyl)-6-(oxolan-2-ylmethoxy)indole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cn(S(=O)(=O)c2ccccc2)c2cc(OCC3CCCO3)ccc12 |
| InChI | InChI=1S/C19H18ClNO6S2/c20-28(22,23)19-12-21(29(24,25)16-6-2-1-3-7-16)18-11-14(8-9-17(18)19)27-13-15-5-4-10-26-15/h1-3,6-9,11-12,15H,4-5,10,13H2 |
| InChIKey | GPOZUVANNLBJRP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |