C8H14N2 — CID 135210358
N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylidenemethanimidamide (PubChem CID 135210358) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylidenemethanimidamide.
| Compound Name | N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 135210358 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-[(E)-2,3-dimethylbut-1-enyl]-N-methylidenemethanimidamide |
| SMILES | C=N/C=N/C=C(\C)C(C)C |
| InChI | InChI=1S/C8H14N2/c1-7(2)8(3)5-10-6-9-4/h5-7H,4H2,1-3H3/b8-5+,10-6+ |
| InChIKey | QDUZPBQAXXNWLC-YLDLMLGBSA-N |
| XLogP | 2.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|