C9H13F3N2 — CID 147395961
N'-[(E)-2,3-dimethylbut-1-enyl]-2,2,2-trifluoro-N-methylideneethanimidamide (PubChem CID 147395961) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is N'-[(E)-2,3-dimethylbut-1-enyl]-2,2,2-trifluoro-N-methylideneethanimidamide.
| Compound Name | N'-[(E)-2,3-dimethylbut-1-enyl]-2,2,2-trifluoro-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 147395961 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | N'-[(E)-2,3-dimethylbut-1-enyl]-2,2,2-trifluoro-N-methylideneethanimidamide |
| SMILES | C=N/C(=N\C=C(/C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-6(2)7(3)5-14-8(13-4)9(10,11)12/h5-6H,4H2,1-3H3/b7-5+,14-8- |
| InChIKey | DNUFEEXKEBOKQR-USFPABIYSA-N |
| XLogP | 3.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|