C22H33N3OS — CID 135214165
3-[(2R)-1-(2,3-dihydrothiophen-4-yl)propan-2-yl]-1-[2-(dimethylamino)-3-phenylpropyl]-1-prop-2-enylurea (PubChem CID 135214165) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 3-[(2R)-1-(2,3-dihydrothiophen-4-yl)propan-2-yl]-1-[2-(dimethylamino)-3-phenylpropyl]-1-prop-2-enylurea.
| Compound Name | 3-[(2R)-1-(2,3-dihydrothiophen-4-yl)propan-2-yl]-1-[2-(dimethylamino)-3-phenylpropyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 135214165 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-[(2R)-1-(2,3-dihydrothiophen-4-yl)propan-2-yl]-1-[2-(dimethylamino)-3-phenylpropyl]-1-prop-2-enylurea |
| SMILES | C=CCN(CC(Cc1ccccc1)N(C)C)C(=O)N[C@H](C)CC1=CSCC1 |
| InChI | InChI=1S/C22H33N3OS/c1-5-12-25(22(26)23-18(2)14-20-11-13-27-17-20)16-21(24(3)4)15-19-9-7-6-8-10-19/h5-10,17-18,21H,1,11-16H2,2-4H3,(H,23,26)/t18-,21?/m1/s1 |
| InChIKey | QAHWONBJVOKVPB-ITUIMRKVSA-N |
| XLogP | 4.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|