C50H34N2O2P2S2 — CID 135215065
2,3-bis(3-diphenylphosphorylphenyl)-[1,4]benzodithiino[2,3-b]quinoxaline (PubChem CID 135215065) has the molecular formula C50H34N2O2P2S2 and a molecular weight of 820.92 g/mol. Its IUPAC name is 2,3-bis(3-diphenylphosphorylphenyl)-[1,4]benzodithiino[2,3-b]quinoxaline.
| Compound Name | 2,3-bis(3-diphenylphosphorylphenyl)-[1,4]benzodithiino[2,3-b]quinoxaline |
|---|---|
| PubChem CID | 135215065 |
| Molecular Formula | C50H34N2O2P2S2 |
| Molecular Weight | 820.92 g/mol |
| Exact Mass | 820.15 |
| IUPAC Name | 2,3-bis(3-diphenylphosphorylphenyl)-[1,4]benzodithiino[2,3-b]quinoxaline |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cccc(-c2cc3c(cc2-c2cccc(P(=O)(c4ccccc4)c4ccccc4)c2)Sc2nc4ccccc4nc2S3)c1 |
| InChI | InChI=1S/C50H34N2O2P2S2/c53-55(37-19-5-1-6-20-37,38-21-7-2-8-22-38)41-27-15-17-35(31-41)43-33-47-48(58-50-49(57-47)51-45-29-13-14-30-46(45)52-50)34-44(43)36-18-16-28-42(32-36)56(54,39-23-9-3-10-24-39)40-25-11-4-12-26-40/h1-34H |
| InChIKey | WVUUNIDFEGLERP-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.92 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|