C16H21ClIN5O2 — CID 135217176
tert-butyl 4-(6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazin-8-yl)piperazine-1-carboxylate (PubChem CID 135217176) has the molecular formula C16H21ClIN5O2 and a molecular weight of 477.73 g/mol. Its IUPAC name is tert-butyl 4-(6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazin-8-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazin-8-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135217176 |
| Molecular Formula | C16H21ClIN5O2 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | tert-butyl 4-(6-chloro-3-iodo-2-methylimidazo[1,2-b]pyridazin-8-yl)piperazine-1-carboxylate |
| SMILES | Cc1nc2c(N3CCN(C(=O)OC(C)(C)C)CC3)cc(Cl)nn2c1I |
| InChI | InChI=1S/C16H21ClIN5O2/c1-10-13(18)23-14(19-10)11(9-12(17)20-23)21-5-7-22(8-6-21)15(24)25-16(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | PJJJIYOYRHPSBG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|