C19H31N5O3 — CID 135219469
tert-butyl 4-(5-methyl-6-piperazin-1-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate (PubChem CID 135219469) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl 4-(5-methyl-6-piperazin-1-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-methyl-6-piperazin-1-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 135219469 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl 4-(5-methyl-6-piperazin-1-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate |
| SMILES | Cc1c(OC2CCN(C(=O)OC(C)(C)C)CC2)ncnc1N1CCNCC1 |
| InChI | InChI=1S/C19H31N5O3/c1-14-16(23-11-7-20-8-12-23)21-13-22-17(14)26-15-5-9-24(10-6-15)18(25)27-19(2,3)4/h13,15,20H,5-12H2,1-4H3 |
| InChIKey | QHNUJICOMRZTFV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |