C35H24NO2PS — CID 135219728
4-(4-cyclohexa-2,4-dien-1-yl-18-phenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine (PubChem CID 135219728) has the molecular formula C35H24NO2PS and a molecular weight of 553.62 g/mol. Its IUPAC name is 4-(4-cyclohexa-2,4-dien-1-yl-18-phenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine.
| Compound Name | 4-(4-cyclohexa-2,4-dien-1-yl-18-phenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine |
|---|---|
| PubChem CID | 135219728 |
| Molecular Formula | C35H24NO2PS |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 4-(4-cyclohexa-2,4-dien-1-yl-18-phenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine |
| SMILES | S=P12c3cc(-c4ccccc4)ccc3Oc3ccc(-c4ccncc4)c(c31)Oc1ccc(C3C=CC=CC3)cc12 |
| InChI | InChI=1S/C35H24NO2PS/c40-39-32-21-26(23-7-3-1-4-8-23)11-14-29(32)37-31-16-13-28(25-17-19-36-20-18-25)34(35(31)39)38-30-15-12-27(22-33(30)39)24-9-5-2-6-10-24/h1-9,11-22,24H,10H2 |
| InChIKey | BMSOYZVEZGISNX-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|