C35H22NO2PS — CID 118219796
3-(5,17-diphenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine (PubChem CID 118219796) has the molecular formula C35H22NO2PS and a molecular weight of 551.61 g/mol. Its IUPAC name is 3-(5,17-diphenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine.
| Compound Name | 3-(5,17-diphenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine |
|---|---|
| PubChem CID | 118219796 |
| Molecular Formula | C35H22NO2PS |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 3-(5,17-diphenyl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-10-yl)pyridine |
| SMILES | S=P12c3ccc(-c4ccccc4)cc3Oc3ccc(-c4cccnc4)c(c31)Oc1cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C35H22NO2PS/c40-39-32-17-13-25(23-8-3-1-4-9-23)20-30(32)37-29-16-15-28(27-12-7-19-36-22-27)34(35(29)39)38-31-21-26(14-18-33(31)39)24-10-5-2-6-11-24/h1-22H |
| InChIKey | YFDGOHPLNOSHKZ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|