C35H24NO3P — CID 144878887
17-cyclohexa-1,5-dien-1-yl-5-phenyl-10-pyridin-3-yl-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 1-oxide (PubChem CID 144878887) has the molecular formula C35H24NO3P and a molecular weight of 537.56 g/mol. Its IUPAC name is 17-cyclohexa-1,5-dien-1-yl-5-phenyl-10-pyridin-3-yl-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 1-oxide.
| Compound Name | 17-cyclohexa-1,5-dien-1-yl-5-phenyl-10-pyridin-3-yl-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 1-oxide |
|---|---|
| PubChem CID | 144878887 |
| Molecular Formula | C35H24NO3P |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 17-cyclohexa-1,5-dien-1-yl-5-phenyl-10-pyridin-3-yl-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene 1-oxide |
| SMILES | O=P12c3ccc(C4=CCCC=C4)cc3Oc3ccc(-c4cccnc4)c(c31)Oc1cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C35H24NO3P/c37-40-32-17-13-25(23-8-3-1-4-9-23)20-30(32)38-29-16-15-28(27-12-7-19-36-22-27)34(35(29)40)39-31-21-26(14-18-33(31)40)24-10-5-2-6-11-24/h2-3,5-22H,1,4H2 |
| InChIKey | OILXEBPSEDGVBP-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|