C26H31Cl2N2O2P — CID 135219842
N-[[2,6-bis(4-chlorophenoxy)phenyl]-(diethylamino)phosphanyl]-N-ethylethanamine (PubChem CID 135219842) has the molecular formula C26H31Cl2N2O2P and a molecular weight of 505.43 g/mol. Its IUPAC name is N-[[2,6-bis(4-chlorophenoxy)phenyl]-(diethylamino)phosphanyl]-N-ethylethanamine.
| Compound Name | N-[[2,6-bis(4-chlorophenoxy)phenyl]-(diethylamino)phosphanyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 135219842 |
| Molecular Formula | C26H31Cl2N2O2P |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[[2,6-bis(4-chlorophenoxy)phenyl]-(diethylamino)phosphanyl]-N-ethylethanamine |
| SMILES | CCN(CC)P(c1c(Oc2ccc(Cl)cc2)cccc1Oc1ccc(Cl)cc1)N(CC)CC |
| InChI | InChI=1S/C26H31Cl2N2O2P/c1-5-29(6-2)33(30(7-3)8-4)26-24(31-22-16-12-20(27)13-17-22)10-9-11-25(26)32-23-18-14-21(28)15-19-23/h9-19H,5-8H2,1-4H3 |
| InChIKey | MESURKKJOATKQH-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|