C25H40N2O10 — CID 135222481
ethyl 2-[3-[2-[(2-ethoxy-2-oxoacetyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]pent-4-enyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxoacetate (PubChem CID 135222481) has the molecular formula C25H40N2O10 and a molecular weight of 528.60 g/mol. Its IUPAC name is ethyl 2-[3-[2-[(2-ethoxy-2-oxoacetyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]pent-4-enyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[3-[2-[(2-ethoxy-2-oxoacetyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]pent-4-enyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 135222481 |
| Molecular Formula | C25H40N2O10 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | ethyl 2-[3-[2-[(2-ethoxy-2-oxoacetyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]pent-4-enyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-oxoacetate |
| SMILES | C=CC(CCN(C(=O)OC(C)(C)C)C(=O)C(=O)OCC)CCN(C(=O)OC(C)(C)C)C(=O)C(=O)OCC |
| InChI | InChI=1S/C25H40N2O10/c1-10-17(13-15-26(18(28)20(30)34-11-2)22(32)36-24(4,5)6)14-16-27(19(29)21(31)35-12-3)23(33)37-25(7,8)9/h10,17H,1,11-16H2,2-9H3 |
| InChIKey | HUWYADZAPYLSIE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|