C16H17N3O3 — CID 135222661
3-ethyl-2-(pyridin-4-ylmethylcarbamoylamino)benzoic acid (PubChem CID 135222661) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-ethyl-2-(pyridin-4-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 3-ethyl-2-(pyridin-4-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 135222661 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-ethyl-2-(pyridin-4-ylmethylcarbamoylamino)benzoic acid |
| SMILES | CCc1cccc(C(=O)O)c1NC(=O)NCc1ccncc1 |
| InChI | InChI=1S/C16H17N3O3/c1-2-12-4-3-5-13(15(20)21)14(12)19-16(22)18-10-11-6-8-17-9-7-11/h3-9H,2,10H2,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | KHWCOAYHGBOEJF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |