About 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate
2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate (PubChem CID 135223649) has the molecular formula C14H21O6PS2
and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate |
| PubChem CID | 135223649 |
| Molecular Formula | C14H21O6PS2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate |
| SMILES | CCOP(C)(=O)OCCSSCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H21O6PS2/c1-3-19-21(2,17)20-9-11-23-22-10-8-18-14(16)12-4-6-13(15)7-5-12/h4-7,15H,3,8-11H2,1-2H3 |
| InChIKey | RBPOWAZJIAEUMQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate?
The IUPAC name of 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate (CID 135223649) is 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate.
What is the SMILES notation for 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate?
The canonical SMILES for 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate is CCOP(C)(=O)OCCSSCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate?
The InChIKey is RBPOWAZJIAEUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21O6PS2/c1-3-19-21(2,17)20-9-11-23-22-10-8-18-14(16)12-4-6-13(15)7-5-12/h4-7,15H,3,8-11H2,1-2H3.
What are the key properties of 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate?
2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate has a molecular weight of 380.42 g/mol, XLogP of 3.81, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[ethoxy(methyl)phosphoryl]oxyethyldisulfanyl]ethyl 4-hydroxybenzoate is sourced from PubChem (CID 135223649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).