C16H28O4 — CID 135224860
[(4Z,7Z)-8-methoxy-2-methylocta-4,7-dien-2-yl] 3-methylbutan-2-yl carbonate (PubChem CID 135224860) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is [(4Z,7Z)-8-methoxy-2-methylocta-4,7-dien-2-yl] 3-methylbutan-2-yl carbonate.
| Compound Name | [(4Z,7Z)-8-methoxy-2-methylocta-4,7-dien-2-yl] 3-methylbutan-2-yl carbonate |
|---|---|
| PubChem CID | 135224860 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [(4Z,7Z)-8-methoxy-2-methylocta-4,7-dien-2-yl] 3-methylbutan-2-yl carbonate |
| SMILES | CO/C=C\C/C=C\CC(C)(C)OC(=O)OC(C)C(C)C |
| InChI | InChI=1S/C16H28O4/c1-13(2)14(3)19-15(17)20-16(4,5)11-9-7-8-10-12-18-6/h7,9-10,12-14H,8,11H2,1-6H3/b9-7-,12-10- |
| InChIKey | QXDJBCUUFHEILK-GEHMVYPESA-N |
| XLogP | 4.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|