C21H36O3 — CID 135224945
2-methylpentyl [(4Z,7Z,10Z)-2-methyltrideca-4,7,10-trien-2-yl] carbonate (PubChem CID 135224945) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-methylpentyl [(4Z,7Z,10Z)-2-methyltrideca-4,7,10-trien-2-yl] carbonate.
| Compound Name | 2-methylpentyl [(4Z,7Z,10Z)-2-methyltrideca-4,7,10-trien-2-yl] carbonate |
|---|---|
| PubChem CID | 135224945 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 2-methylpentyl [(4Z,7Z,10Z)-2-methyltrideca-4,7,10-trien-2-yl] carbonate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(C)(C)OC(=O)OCC(C)CCC |
| InChI | InChI=1S/C21H36O3/c1-6-8-9-10-11-12-13-14-15-17-21(4,5)24-20(22)23-18-19(3)16-7-2/h8-9,11-12,14-15,19H,6-7,10,13,16-18H2,1-5H3/b9-8-,12-11-,15-14- |
| InChIKey | UPAGOKXILWCDLD-ORZIMQNZSA-N |
| XLogP | 6.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|