C54H87O6P — CID 91282744
tert-butyl [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] carbonate;[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-methylphosphinic acid (PubChem CID 91282744) has the molecular formula C54H87O6P and a molecular weight of 863.26 g/mol. Its IUPAC name is tert-butyl [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] carbonate;[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-methylphosphinic acid.
| Compound Name | tert-butyl [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] carbonate;[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 91282744 |
| Molecular Formula | C54H87O6P |
| Molecular Weight | 863.26 g/mol |
| Exact Mass | 862.62 |
| IUPAC Name | tert-butyl [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] carbonate;[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-methylphosphinic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(CC)COC(=O)OC(C)(C)C.CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(CC)COP(C)(=O)O |
| InChI | InChI=1S/C29H46O3.C25H41O3P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27(7-2)26-31-28(30)32-29(3,4)5;1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(5-2)24-28-29(3,26)27/h8-9,11-12,14-15,17-18,20-21,23-24,27H,6-7,10,13,16,19,22,25-26H2,1-5H3;6-7,9-10,12-13,15-16,18-19,21-22,25H,4-5,8,11,14,17,20,23-24H2,1-3H3,(H,26,27)/b9-8-,12-11-,15-14-,18-17-,21-20-,24-23-;7-6-,10-9-,13-12-,16-15-,19-18-,22-21- |
| InChIKey | YATDHCVDYBGTAK-ZLOQNHMFSA-N |
| XLogP | 16.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.26 |
| LogP ≤ 5 | 16.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|