C26H43O4P — CID 89228265
[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dimethyl phosphate (PubChem CID 89228265) has the molecular formula C26H43O4P and a molecular weight of 450.60 g/mol. Its IUPAC name is [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dimethyl phosphate.
| Compound Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dimethyl phosphate |
|---|---|
| PubChem CID | 89228265 |
| Molecular Formula | C26H43O4P |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | [(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenyl] dimethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(CC)COP(=O)(OC)OC |
| InChI | InChI=1S/C26H43O4P/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26(6-2)25-30-31(27,28-3)29-4/h7-8,10-11,13-14,16-17,19-20,22-23,26H,5-6,9,12,15,18,21,24-25H2,1-4H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | PFJRDMPMNXBCKO-XTJKPUCJSA-N |
| XLogP | 8.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|