C22H38O8P2 — CID 142700315
[(5E,8E,11E,14E,17E)-2-ethyl-20-phosphonooxyicosa-5,8,11,14,17-pentaenyl] dihydrogen phosphate (PubChem CID 142700315) has the molecular formula C22H38O8P2 and a molecular weight of 492.49 g/mol. Its IUPAC name is [(5E,8E,11E,14E,17E)-2-ethyl-20-phosphonooxyicosa-5,8,11,14,17-pentaenyl] dihydrogen phosphate.
| Compound Name | [(5E,8E,11E,14E,17E)-2-ethyl-20-phosphonooxyicosa-5,8,11,14,17-pentaenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 142700315 |
| Molecular Formula | C22H38O8P2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | [(5E,8E,11E,14E,17E)-2-ethyl-20-phosphonooxyicosa-5,8,11,14,17-pentaenyl] dihydrogen phosphate |
| SMILES | CCC(CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCOP(=O)(O)O)COP(=O)(O)O |
| InChI | InChI=1S/C22H38O8P2/c1-2-22(21-30-32(26,27)28)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-29-31(23,24)25/h3-4,7-10,13-16,22H,2,5-6,11-12,17-21H2,1H3,(H2,23,24,25)(H2,26,27,28)/b4-3+,9-7+,10-8+,15-13+,16-14+ |
| InChIKey | IAXNFVKQCHOMHK-BUWCKPMYSA-N |
| XLogP | 5.74 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|