C17H33O7P — CID 126725941
[(2R)-2-hydroxy-3-[(5Z,8Z)-1-hydroxytetradeca-5,8-dienoxy]propyl] dihydrogen phosphate (PubChem CID 126725941) has the molecular formula C17H33O7P and a molecular weight of 380.42 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-[(5Z,8Z)-1-hydroxytetradeca-5,8-dienoxy]propyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-hydroxy-3-[(5Z,8Z)-1-hydroxytetradeca-5,8-dienoxy]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 126725941 |
| Molecular Formula | C17H33O7P |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(2R)-2-hydroxy-3-[(5Z,8Z)-1-hydroxytetradeca-5,8-dienoxy]propyl] dihydrogen phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCC(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C17H33O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(19)23-14-16(18)15-24-25(20,21)22/h6-7,9-10,16-19H,2-5,8,11-15H2,1H3,(H2,20,21,22)/b7-6-,10-9-/t16-,17?/m1/s1 |
| InChIKey | PZIHXPJKNFIXAD-KNFSQSKESA-N |
| XLogP | 3.04 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|